cmikhail40731 cmikhail40731

22-03-2024
Mathematics

contestada

Two vectors are given as follows: A= -2i -5j +2k B= -5i -2j -3k find the magnitude of the following vector A x B

Respuesta :

Otras preguntas

Solve (X + 6)(x - 4) = -16 O {-4, 6) O {-4, 2] O (-12, 22)

If h(x) = 6 - X, what is the value of (han)(10)?

Classify each of these reactions. Ba(ClO3)2(s)⟶BaCl2(s)+3O2(g)Ba(ClO3)2(s)⟶BaCl2(s)+3O2(g) acid–base neutralization precipitation redox none of the above 2NaCl(

The graph of y=-0.2x² is ? the graph of y=x².There are options to answer this question.Choose one of the best answers.A. Narrower than and opens in the same dir

PLS HELP ME!!!the base length of a triangle is 12 ft and the height is 6 ft. what is the area of the triangle.a. 10 sq. ftb. 12 sq. ftc. 18 sq. ftd. 36 sq. ft

I know this probably isn't the best website for this kind of question but i'm getting real depressed more and more each day and I just don't know what to do lif

z PolntsIn the study of history, what is one major difference between a theme and aperiod?

Please help!! Local wildlife experts have begun to track the population of trout in their area. The function f represents the approximate population of trout in

Are all of the roots of the polynomial p(x)=x^3+3x^2-11x-5 rational numbers? Why or why not?

Which sentence fails to use correct parallel structure? A)the dentist told the classroom of kindergarteners that they each needed to floss,brush,and rinse daily