xxfatalfanboyxx xxfatalfanboyxx

26-02-2020
Mathematics

contestada

20 points! please help

20 points please help class=

Respuesta :

dbcervantes6 dbcervantes6

26-02-2020

Answer:

l is parallel to p

Step-by-step explanation:

180-112=68 = 180-68= 112

basically the answer is 68

Answer Link

Otras preguntas

Write the mixed number as an improper fraction. 33/5

Given that XY is a line segment with the angle a= 21 and c = 33 work out the value of the angle marked b

If you were able to add an amendment to the U.S. Constitution what would it be?

what features of sikhism created a distinct religious community

Which of the following is the correct structure of 2-methyl-3-heptenea. CH3-CH2-C(CH3)=CH-CH2-CH2-CH3b. CH3-CH2CH=CH-CH2CH(CH3)-CH3c. CH3-CH2-CH=CH-CH-(CH3)-CH2

When are collective nouns said to be plural? A. when there is more than one of the same kind of group B. when there is more than one object in a group O c. when

Tim goes on a car journey. for the first 15 minutes his average speed is 40 mph he then stops for 25 minutes he then completes the journey at an average speed o

PLEASE HELP ME URGENT DUE IN 10 MIN can someone please compute Q1, Q3, Q

PLEASE HELPPPPPP Solve the following equation (showing all work). X + 6 = 10

A contractor bought 7.6 ft2 of sheet metal. She has used 3.5 ft2 so far and has $123 worth of sheet metal remaining. The equation 7.6x−3.5x=123 represents how